C32H30ClN5O2S — CID 21171010
(E)-N-[[2-(4-butylphenyl)-6-methylbenzotriazol-5-yl]carbamothioyl]-3-[5-(3-chloro-4-methylphenyl)furan-2-yl]prop-2-enamide (PubChem CID 21171010) has the molecular formula C32H30ClN5O2S and a molecular weight of 584.15 g/mol. Its IUPAC name is (E)-N-[[2-(4-butylphenyl)-6-methylbenzotriazol-5-yl]carbamothioyl]-3-[5-(3-chloro-4-methylphenyl)furan-2-yl]prop-2-enamide.
| Compound Name | (E)-N-[[2-(4-butylphenyl)-6-methylbenzotriazol-5-yl]carbamothioyl]-3-[5-(3-chloro-4-methylphenyl)furan-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 21171010 |
| Molecular Formula | C32H30ClN5O2S |
| Molecular Weight | 584.15 g/mol |
| Exact Mass | 583.18 |
| IUPAC Name | (E)-N-[[2-(4-butylphenyl)-6-methylbenzotriazol-5-yl]carbamothioyl]-3-[5-(3-chloro-4-methylphenyl)furan-2-yl]prop-2-enamide |
| SMILES | CCCCc1ccc(-n2nc3cc(C)c(NC(=S)NC(=O)/C=C/c4ccc(-c5ccc(C)c(Cl)c5)o4)cc3n2)cc1 |
| InChI | InChI=1S/C32H30ClN5O2S/c1-4-5-6-22-8-11-24(12-9-22)38-36-28-17-21(3)27(19-29(28)37-38)34-32(41)35-31(39)16-14-25-13-15-30(40-25)23-10-7-20(2)26(33)18-23/h7-19H,4-6H2,1-3H3,(H2,34,35,39,41)/b16-14+ |
| InChIKey | JGYVOGMHABSLDD-JQIJEIRASA-N |
| XLogP | 7.82 |
| TPSA | 84.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.15 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|