C26H23Cl2N5OS — CID 17316963
(E)-N-[[2-(4-butylphenyl)-6-chlorobenzotriazol-5-yl]carbamothioyl]-3-(4-chlorophenyl)prop-2-enamide (PubChem CID 17316963) has the molecular formula C26H23Cl2N5OS and a molecular weight of 524.48 g/mol. Its IUPAC name is (E)-N-[[2-(4-butylphenyl)-6-chlorobenzotriazol-5-yl]carbamothioyl]-3-(4-chlorophenyl)prop-2-enamide.
| Compound Name | (E)-N-[[2-(4-butylphenyl)-6-chlorobenzotriazol-5-yl]carbamothioyl]-3-(4-chlorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 17316963 |
| Molecular Formula | C26H23Cl2N5OS |
| Molecular Weight | 524.48 g/mol |
| Exact Mass | 523.10 |
| IUPAC Name | (E)-N-[[2-(4-butylphenyl)-6-chlorobenzotriazol-5-yl]carbamothioyl]-3-(4-chlorophenyl)prop-2-enamide |
| SMILES | CCCCc1ccc(-n2nc3cc(Cl)c(NC(=S)NC(=O)/C=C/c4ccc(Cl)cc4)cc3n2)cc1 |
| InChI | InChI=1S/C26H23Cl2N5OS/c1-2-3-4-17-7-12-20(13-8-17)33-31-23-15-21(28)22(16-24(23)32-33)29-26(35)30-25(34)14-9-18-5-10-19(27)11-6-18/h5-16H,2-4H2,1H3,(H2,29,30,34,35)/b14-9+ |
| InChIKey | PNFISKAKSANKCJ-NTEUORMPSA-N |
| XLogP | 6.60 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.48 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|