C25H24ClN5O2S — CID 4988716
N-[[2-(4-butylphenyl)-6-chlorobenzotriazol-5-yl]carbamothioyl]-2-methoxybenzamide (PubChem CID 4988716) has the molecular formula C25H24ClN5O2S and a molecular weight of 494.02 g/mol. Its IUPAC name is N-[[2-(4-butylphenyl)-6-chlorobenzotriazol-5-yl]carbamothioyl]-2-methoxybenzamide.
| Compound Name | N-[[2-(4-butylphenyl)-6-chlorobenzotriazol-5-yl]carbamothioyl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 4988716 |
| Molecular Formula | C25H24ClN5O2S |
| Molecular Weight | 494.02 g/mol |
| Exact Mass | 493.13 |
| IUPAC Name | N-[[2-(4-butylphenyl)-6-chlorobenzotriazol-5-yl]carbamothioyl]-2-methoxybenzamide |
| SMILES | CCCCc1ccc(-n2nc3cc(Cl)c(NC(=S)NC(=O)c4ccccc4OC)cc3n2)cc1 |
| InChI | InChI=1S/C25H24ClN5O2S/c1-3-4-7-16-10-12-17(13-11-16)31-29-21-14-19(26)20(15-22(21)30-31)27-25(34)28-24(32)18-8-5-6-9-23(18)33-2/h5-6,8-15H,3-4,7H2,1-2H3,(H2,27,28,32,34) |
| InChIKey | ZVGLBKMGYZIEED-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.02 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|