C28H22Cl3N5O2S — CID 17316976
N-[[2-(4-butylphenyl)-6-chlorobenzotriazol-5-yl]carbamothioyl]-5-(3,4-dichlorophenyl)furan-2-carboxamide (PubChem CID 17316976) has the molecular formula C28H22Cl3N5O2S and a molecular weight of 598.94 g/mol. Its IUPAC name is N-[[2-(4-butylphenyl)-6-chlorobenzotriazol-5-yl]carbamothioyl]-5-(3,4-dichlorophenyl)furan-2-carboxamide.
| Compound Name | N-[[2-(4-butylphenyl)-6-chlorobenzotriazol-5-yl]carbamothioyl]-5-(3,4-dichlorophenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 17316976 |
| Molecular Formula | C28H22Cl3N5O2S |
| Molecular Weight | 598.94 g/mol |
| Exact Mass | 597.06 |
| IUPAC Name | N-[[2-(4-butylphenyl)-6-chlorobenzotriazol-5-yl]carbamothioyl]-5-(3,4-dichlorophenyl)furan-2-carboxamide |
| SMILES | CCCCc1ccc(-n2nc3cc(Cl)c(NC(=S)NC(=O)c4ccc(-c5ccc(Cl)c(Cl)c5)o4)cc3n2)cc1 |
| InChI | InChI=1S/C28H22Cl3N5O2S/c1-2-3-4-16-5-8-18(9-6-16)36-34-23-14-21(31)22(15-24(23)35-36)32-28(39)33-27(37)26-12-11-25(38-26)17-7-10-19(29)20(30)13-17/h5-15H,2-4H2,1H3,(H2,32,33,37,39) |
| InChIKey | VRGMINLQNJKYLV-UHFFFAOYSA-N |
| XLogP | 8.11 |
| TPSA | 84.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.94 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|