C27H22ClN5O2S — CID 17115239
5-(3-chlorophenyl)-N-[[2-(4-ethylphenyl)-6-methylbenzotriazol-5-yl]carbamothioyl]furan-2-carboxamide (PubChem CID 17115239) has the molecular formula C27H22ClN5O2S and a molecular weight of 516.03 g/mol. Its IUPAC name is 5-(3-chlorophenyl)-N-[[2-(4-ethylphenyl)-6-methylbenzotriazol-5-yl]carbamothioyl]furan-2-carboxamide.
| Compound Name | 5-(3-chlorophenyl)-N-[[2-(4-ethylphenyl)-6-methylbenzotriazol-5-yl]carbamothioyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 17115239 |
| Molecular Formula | C27H22ClN5O2S |
| Molecular Weight | 516.03 g/mol |
| Exact Mass | 515.12 |
| IUPAC Name | 5-(3-chlorophenyl)-N-[[2-(4-ethylphenyl)-6-methylbenzotriazol-5-yl]carbamothioyl]furan-2-carboxamide |
| SMILES | CCc1ccc(-n2nc3cc(C)c(NC(=S)NC(=O)c4ccc(-c5cccc(Cl)c5)o4)cc3n2)cc1 |
| InChI | InChI=1S/C27H22ClN5O2S/c1-3-17-7-9-20(10-8-17)33-31-22-13-16(2)21(15-23(22)32-33)29-27(36)30-26(34)25-12-11-24(35-25)18-5-4-6-19(28)14-18/h4-15H,3H2,1-2H3,(H2,29,30,34,36) |
| InChIKey | BHSZXMARZUTLKD-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 84.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.03 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|