C23H19Cl2N5OS — CID 17115214
2,4-dichloro-N-[[2-(4-ethylphenyl)-6-methylbenzotriazol-5-yl]carbamothioyl]benzamide (PubChem CID 17115214) has the molecular formula C23H19Cl2N5OS and a molecular weight of 484.41 g/mol. Its IUPAC name is 2,4-dichloro-N-[[2-(4-ethylphenyl)-6-methylbenzotriazol-5-yl]carbamothioyl]benzamide.
| Compound Name | 2,4-dichloro-N-[[2-(4-ethylphenyl)-6-methylbenzotriazol-5-yl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 17115214 |
| Molecular Formula | C23H19Cl2N5OS |
| Molecular Weight | 484.41 g/mol |
| Exact Mass | 483.07 |
| IUPAC Name | 2,4-dichloro-N-[[2-(4-ethylphenyl)-6-methylbenzotriazol-5-yl]carbamothioyl]benzamide |
| SMILES | CCc1ccc(-n2nc3cc(C)c(NC(=S)NC(=O)c4ccc(Cl)cc4Cl)cc3n2)cc1 |
| InChI | InChI=1S/C23H19Cl2N5OS/c1-3-14-4-7-16(8-5-14)30-28-20-10-13(2)19(12-21(20)29-30)26-23(32)27-22(31)17-9-6-15(24)11-18(17)25/h4-12H,3H2,1-2H3,(H2,26,27,31,32) |
| InChIKey | DKLZUADHSASRON-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.41 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|