C27H29ClN6OS — CID 17316815
2-chloro-N-[[2-[4-(diethylamino)-2-methylphenyl]-6-methylbenzotriazol-5-yl]carbamothioyl]-4-methylbenzamide (PubChem CID 17316815) has the molecular formula C27H29ClN6OS and a molecular weight of 521.09 g/mol. Its IUPAC name is 2-chloro-N-[[2-[4-(diethylamino)-2-methylphenyl]-6-methylbenzotriazol-5-yl]carbamothioyl]-4-methylbenzamide.
| Compound Name | 2-chloro-N-[[2-[4-(diethylamino)-2-methylphenyl]-6-methylbenzotriazol-5-yl]carbamothioyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 17316815 |
| Molecular Formula | C27H29ClN6OS |
| Molecular Weight | 521.09 g/mol |
| Exact Mass | 520.18 |
| IUPAC Name | 2-chloro-N-[[2-[4-(diethylamino)-2-methylphenyl]-6-methylbenzotriazol-5-yl]carbamothioyl]-4-methylbenzamide |
| SMILES | CCN(CC)c1ccc(-n2nc3cc(C)c(NC(=S)NC(=O)c4ccc(C)cc4Cl)cc3n2)c(C)c1 |
| InChI | InChI=1S/C27H29ClN6OS/c1-6-33(7-2)19-9-11-25(18(5)13-19)34-31-23-14-17(4)22(15-24(23)32-34)29-27(36)30-26(35)20-10-8-16(3)12-21(20)28/h8-15H,6-7H2,1-5H3,(H2,29,30,35,36) |
| InChIKey | AQAVKFYZPDLQIJ-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 75.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.09 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|