C31H36N6OS — CID 17316872
(E)-N-[[2-[4-(diethylamino)-2-methylphenyl]-6-methylbenzotriazol-5-yl]carbamothioyl]-3-(4-propan-2-ylphenyl)prop-2-enamide (PubChem CID 17316872) has the molecular formula C31H36N6OS and a molecular weight of 540.74 g/mol. Its IUPAC name is (E)-N-[[2-[4-(diethylamino)-2-methylphenyl]-6-methylbenzotriazol-5-yl]carbamothioyl]-3-(4-propan-2-ylphenyl)prop-2-enamide.
| Compound Name | (E)-N-[[2-[4-(diethylamino)-2-methylphenyl]-6-methylbenzotriazol-5-yl]carbamothioyl]-3-(4-propan-2-ylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 17316872 |
| Molecular Formula | C31H36N6OS |
| Molecular Weight | 540.74 g/mol |
| Exact Mass | 540.27 |
| IUPAC Name | (E)-N-[[2-[4-(diethylamino)-2-methylphenyl]-6-methylbenzotriazol-5-yl]carbamothioyl]-3-(4-propan-2-ylphenyl)prop-2-enamide |
| SMILES | CCN(CC)c1ccc(-n2nc3cc(C)c(NC(=S)NC(=O)/C=C/c4ccc(C(C)C)cc4)cc3n2)c(C)c1 |
| InChI | InChI=1S/C31H36N6OS/c1-7-36(8-2)25-14-15-29(22(6)17-25)37-34-27-18-21(5)26(19-28(27)35-37)32-31(39)33-30(38)16-11-23-9-12-24(13-10-23)20(3)4/h9-20H,7-8H2,1-6H3,(H2,32,33,38,39)/b16-11+ |
| InChIKey | LQWQGIHIHQEDOI-LFIBNONCSA-N |
| XLogP | 6.53 |
| TPSA | 75.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.74 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|