C30H36N6O2S — CID 17316841
3-butoxy-N-[[2-[4-(diethylamino)-2-methylphenyl]-6-methylbenzotriazol-5-yl]carbamothioyl]benzamide (PubChem CID 17316841) has the molecular formula C30H36N6O2S and a molecular weight of 544.73 g/mol. Its IUPAC name is 3-butoxy-N-[[2-[4-(diethylamino)-2-methylphenyl]-6-methylbenzotriazol-5-yl]carbamothioyl]benzamide.
| Compound Name | 3-butoxy-N-[[2-[4-(diethylamino)-2-methylphenyl]-6-methylbenzotriazol-5-yl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 17316841 |
| Molecular Formula | C30H36N6O2S |
| Molecular Weight | 544.73 g/mol |
| Exact Mass | 544.26 |
| IUPAC Name | 3-butoxy-N-[[2-[4-(diethylamino)-2-methylphenyl]-6-methylbenzotriazol-5-yl]carbamothioyl]benzamide |
| SMILES | CCCCOc1cccc(C(=O)NC(=S)Nc2cc3nn(-c4ccc(N(CC)CC)cc4C)nc3cc2C)c1 |
| InChI | InChI=1S/C30H36N6O2S/c1-6-9-15-38-24-12-10-11-22(18-24)29(37)32-30(39)31-25-19-27-26(17-20(25)4)33-36(34-27)28-14-13-23(16-21(28)5)35(7-2)8-3/h10-14,16-19H,6-9,15H2,1-5H3,(H2,31,32,37,39) |
| InChIKey | LBDOFPOZLJNAJG-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 84.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.73 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|