C25H25BrN6OS — CID 21168828
3-bromo-N-[[2-[4-(diethylamino)phenyl]-6-methylbenzotriazol-5-yl]carbamothioyl]benzamide (PubChem CID 21168828) has the molecular formula C25H25BrN6OS and a molecular weight of 537.49 g/mol. Its IUPAC name is 3-bromo-N-[[2-[4-(diethylamino)phenyl]-6-methylbenzotriazol-5-yl]carbamothioyl]benzamide.
| Compound Name | 3-bromo-N-[[2-[4-(diethylamino)phenyl]-6-methylbenzotriazol-5-yl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 21168828 |
| Molecular Formula | C25H25BrN6OS |
| Molecular Weight | 537.49 g/mol |
| Exact Mass | 536.10 |
| IUPAC Name | 3-bromo-N-[[2-[4-(diethylamino)phenyl]-6-methylbenzotriazol-5-yl]carbamothioyl]benzamide |
| SMILES | CCN(CC)c1ccc(-n2nc3cc(C)c(NC(=S)NC(=O)c4cccc(Br)c4)cc3n2)cc1 |
| InChI | InChI=1S/C25H25BrN6OS/c1-4-31(5-2)19-9-11-20(12-10-19)32-29-22-13-16(3)21(15-23(22)30-32)27-25(34)28-24(33)17-7-6-8-18(26)14-17/h6-15H,4-5H2,1-3H3,(H2,27,28,33,34) |
| InChIKey | ILKNIKFYHDVUAE-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 75.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.49 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|