C27H29N7O4S — CID 21169467
N-[[2-[4-(diethylamino)phenyl]-6-methylbenzotriazol-5-yl]carbamothioyl]-4-ethoxy-3-nitrobenzamide (PubChem CID 21169467) has the molecular formula C27H29N7O4S and a molecular weight of 547.64 g/mol. Its IUPAC name is N-[[2-[4-(diethylamino)phenyl]-6-methylbenzotriazol-5-yl]carbamothioyl]-4-ethoxy-3-nitrobenzamide.
| Compound Name | N-[[2-[4-(diethylamino)phenyl]-6-methylbenzotriazol-5-yl]carbamothioyl]-4-ethoxy-3-nitrobenzamide |
|---|---|
| PubChem CID | 21169467 |
| Molecular Formula | C27H29N7O4S |
| Molecular Weight | 547.64 g/mol |
| Exact Mass | 547.20 |
| IUPAC Name | N-[[2-[4-(diethylamino)phenyl]-6-methylbenzotriazol-5-yl]carbamothioyl]-4-ethoxy-3-nitrobenzamide |
| SMILES | CCOc1ccc(C(=O)NC(=S)Nc2cc3nn(-c4ccc(N(CC)CC)cc4)nc3cc2C)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C27H29N7O4S/c1-5-32(6-2)19-9-11-20(12-10-19)33-30-22-14-17(4)21(16-23(22)31-33)28-27(39)29-26(35)18-8-13-25(38-7-3)24(15-18)34(36)37/h8-16H,5-7H2,1-4H3,(H2,28,29,35,39) |
| InChIKey | GLFKZKLAPGHTDG-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 127.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.64 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|