C17H14N3O6S- — CID 2296882
4-[(4-ethoxy-3-nitrobenzoyl)carbamothioylamino]benzoate (PubChem CID 2296882) has the molecular formula C17H14N3O6S- and a molecular weight of 388.38 g/mol. Its IUPAC name is 4-[(4-ethoxy-3-nitrobenzoyl)carbamothioylamino]benzoate.
| Compound Name | 4-[(4-ethoxy-3-nitrobenzoyl)carbamothioylamino]benzoate |
|---|---|
| PubChem CID | 2296882 |
| Molecular Formula | C17H14N3O6S- |
| Molecular Weight | 388.38 g/mol |
| Exact Mass | 388.06 |
| IUPAC Name | 4-[(4-ethoxy-3-nitrobenzoyl)carbamothioylamino]benzoate |
| SMILES | CCOc1ccc(C(=O)NC(=S)Nc2ccc(C(=O)[O-])cc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H15N3O6S/c1-2-26-14-8-5-11(9-13(14)20(24)25)15(21)19-17(27)18-12-6-3-10(4-7-12)16(22)23/h3-9H,2H2,1H3,(H,22,23)(H2,18,19,21,27)/p-1 |
| InChIKey | AYCKKUHZJYMHEO-UHFFFAOYSA-M |
| XLogP | 1.48 |
| TPSA | 133.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.38 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|