C20H23N3O6S — CID 2899794
3,4,5-triethoxy-N-[(4-nitrophenyl)carbamothioyl]benzamide (PubChem CID 2899794) has the molecular formula C20H23N3O6S and a molecular weight of 433.49 g/mol. Its IUPAC name is 3,4,5-triethoxy-N-[(4-nitrophenyl)carbamothioyl]benzamide.
| Compound Name | 3,4,5-triethoxy-N-[(4-nitrophenyl)carbamothioyl]benzamide |
|---|---|
| PubChem CID | 2899794 |
| Molecular Formula | C20H23N3O6S |
| Molecular Weight | 433.49 g/mol |
| Exact Mass | 433.13 |
| IUPAC Name | 3,4,5-triethoxy-N-[(4-nitrophenyl)carbamothioyl]benzamide |
| SMILES | CCOc1cc(C(=O)NC(=S)Nc2ccc([N+](=O)[O-])cc2)cc(OCC)c1OCC |
| InChI | InChI=1S/C20H23N3O6S/c1-4-27-16-11-13(12-17(28-5-2)18(16)29-6-3)19(24)22-20(30)21-14-7-9-15(10-8-14)23(25)26/h7-12H,4-6H2,1-3H3,(H2,21,22,24,30) |
| InChIKey | OJXHAWSGLGJXMP-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 111.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.49 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|