C15H13N5O4S — CID 10043987
N-[[4-(hydrazinecarbonyl)phenyl]carbamothioyl]-4-nitrobenzamide (PubChem CID 10043987) has the molecular formula C15H13N5O4S and a molecular weight of 359.37 g/mol. Its IUPAC name is N-[[4-(hydrazinecarbonyl)phenyl]carbamothioyl]-4-nitrobenzamide.
| Compound Name | N-[[4-(hydrazinecarbonyl)phenyl]carbamothioyl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 10043987 |
| Molecular Formula | C15H13N5O4S |
| Molecular Weight | 359.37 g/mol |
| Exact Mass | 359.07 |
| IUPAC Name | N-[[4-(hydrazinecarbonyl)phenyl]carbamothioyl]-4-nitrobenzamide |
| SMILES | NNC(=O)c1ccc(NC(=S)NC(=O)c2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C15H13N5O4S/c16-19-14(22)10-1-5-11(6-2-10)17-15(25)18-13(21)9-3-7-12(8-4-9)20(23)24/h1-8H,16H2,(H,19,22)(H2,17,18,21,25) |
| InChIKey | SGYAXJZYQCLPFK-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 139.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.37 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|