C14H9Br2N3O4S — CID 5153728
N-[(3,5-dibromo-4-hydroxyphenyl)carbamothioyl]-4-nitrobenzamide (PubChem CID 5153728) has the molecular formula C14H9Br2N3O4S and a molecular weight of 475.12 g/mol. Its IUPAC name is N-[(3,5-dibromo-4-hydroxyphenyl)carbamothioyl]-4-nitrobenzamide.
| Compound Name | N-[(3,5-dibromo-4-hydroxyphenyl)carbamothioyl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 5153728 |
| Molecular Formula | C14H9Br2N3O4S |
| Molecular Weight | 475.12 g/mol |
| Exact Mass | 472.87 |
| IUPAC Name | N-[(3,5-dibromo-4-hydroxyphenyl)carbamothioyl]-4-nitrobenzamide |
| SMILES | O=C(NC(=S)Nc1cc(Br)c(O)c(Br)c1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C14H9Br2N3O4S/c15-10-5-8(6-11(16)12(10)20)17-14(24)18-13(21)7-1-3-9(4-2-7)19(22)23/h1-6,20H,(H2,17,18,21,24) |
| InChIKey | QBYXHBVDUSGYOS-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 104.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.12 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|