C15H13BrN2O2S — CID 91674602
N-[(3-bromo-4-hydroxy-5-methylphenyl)carbamothioyl]benzamide (PubChem CID 91674602) has the molecular formula C15H13BrN2O2S and a molecular weight of 365.25 g/mol. Its IUPAC name is N-[(3-bromo-4-hydroxy-5-methylphenyl)carbamothioyl]benzamide.
| Compound Name | N-[(3-bromo-4-hydroxy-5-methylphenyl)carbamothioyl]benzamide |
|---|---|
| PubChem CID | 91674602 |
| Molecular Formula | C15H13BrN2O2S |
| Molecular Weight | 365.25 g/mol |
| Exact Mass | 363.99 |
| IUPAC Name | N-[(3-bromo-4-hydroxy-5-methylphenyl)carbamothioyl]benzamide |
| SMILES | Cc1cc(NC(=S)NC(=O)c2ccccc2)cc(Br)c1O |
| InChI | InChI=1S/C15H13BrN2O2S/c1-9-7-11(8-12(16)13(9)19)17-15(21)18-14(20)10-5-3-2-4-6-10/h2-8,19H,1H3,(H2,17,18,20,21) |
| InChIKey | LJKYYXRERLHSIL-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.25 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|