C22H20N2O2S — CID 1344932
N-[(2-hydroxy-3,5-dimethylphenyl)carbamothioyl]-4-phenylbenzamide (PubChem CID 1344932) has the molecular formula C22H20N2O2S and a molecular weight of 376.48 g/mol. Its IUPAC name is N-[(2-hydroxy-3,5-dimethylphenyl)carbamothioyl]-4-phenylbenzamide.
| Compound Name | N-[(2-hydroxy-3,5-dimethylphenyl)carbamothioyl]-4-phenylbenzamide |
|---|---|
| PubChem CID | 1344932 |
| Molecular Formula | C22H20N2O2S |
| Molecular Weight | 376.48 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | N-[(2-hydroxy-3,5-dimethylphenyl)carbamothioyl]-4-phenylbenzamide |
| SMILES | Cc1cc(C)c(O)c(NC(=S)NC(=O)c2ccc(-c3ccccc3)cc2)c1 |
| InChI | InChI=1S/C22H20N2O2S/c1-14-12-15(2)20(25)19(13-14)23-22(27)24-21(26)18-10-8-17(9-11-18)16-6-4-3-5-7-16/h3-13,25H,1-2H3,(H2,23,24,26,27) |
| InChIKey | UXKFSNJNTUAWPD-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.48 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|