C24H24N2O2S — CID 56600775
4-tert-butyl-N-[(2-hydroxy-5-phenylphenyl)carbamothioyl]benzamide (PubChem CID 56600775) has the molecular formula C24H24N2O2S and a molecular weight of 404.54 g/mol. Its IUPAC name is 4-tert-butyl-N-[(2-hydroxy-5-phenylphenyl)carbamothioyl]benzamide.
| Compound Name | 4-tert-butyl-N-[(2-hydroxy-5-phenylphenyl)carbamothioyl]benzamide |
|---|---|
| PubChem CID | 56600775 |
| Molecular Formula | C24H24N2O2S |
| Molecular Weight | 404.54 g/mol |
| Exact Mass | 404.16 |
| IUPAC Name | 4-tert-butyl-N-[(2-hydroxy-5-phenylphenyl)carbamothioyl]benzamide |
| SMILES | CC(C)(C)c1ccc(C(=O)NC(=S)Nc2cc(-c3ccccc3)ccc2O)cc1 |
| InChI | InChI=1S/C24H24N2O2S/c1-24(2,3)19-12-9-17(10-13-19)22(28)26-23(29)25-20-15-18(11-14-21(20)27)16-7-5-4-6-8-16/h4-15,27H,1-3H3,(H2,25,26,28,29) |
| InChIKey | NWXSBQIEUIWQFI-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.54 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|