C15H16N3OS+ — CID 142919985
[2-(benzoylcarbamothioylamino)-4-methylphenyl]azanium (PubChem CID 142919985) has the molecular formula C15H16N3OS+ and a molecular weight of 286.38 g/mol. Its IUPAC name is [2-(benzoylcarbamothioylamino)-4-methylphenyl]azanium.
| Compound Name | [2-(benzoylcarbamothioylamino)-4-methylphenyl]azanium |
|---|---|
| PubChem CID | 142919985 |
| Molecular Formula | C15H16N3OS+ |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | [2-(benzoylcarbamothioylamino)-4-methylphenyl]azanium |
| SMILES | Cc1ccc([NH3+])c(NC(=S)NC(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C15H15N3OS/c1-10-7-8-12(16)13(9-10)17-15(20)18-14(19)11-5-3-2-4-6-11/h2-9H,16H2,1H3,(H2,17,18,19,20)/p+1 |
| InChIKey | XBXNYKCDUBJWTR-UHFFFAOYSA-O |
| XLogP | 2.00 |
| TPSA | 68.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|