C16H17N3O3S2 — CID 134113825
N-[[2-(methanesulfonamido)-4-methylphenyl]carbamothioyl]benzamide (PubChem CID 134113825) has the molecular formula C16H17N3O3S2 and a molecular weight of 363.46 g/mol. Its IUPAC name is N-[[2-(methanesulfonamido)-4-methylphenyl]carbamothioyl]benzamide.
| Compound Name | N-[[2-(methanesulfonamido)-4-methylphenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 134113825 |
| Molecular Formula | C16H17N3O3S2 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.07 |
| IUPAC Name | N-[[2-(methanesulfonamido)-4-methylphenyl]carbamothioyl]benzamide |
| SMILES | Cc1ccc(NC(=S)NC(=O)c2ccccc2)c(NS(C)(=O)=O)c1 |
| InChI | InChI=1S/C16H17N3O3S2/c1-11-8-9-13(14(10-11)19-24(2,21)22)17-16(23)18-15(20)12-6-4-3-5-7-12/h3-10,19H,1-2H3,(H2,17,18,20,23) |
| InChIKey | NJWKOZRTIZXJKU-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|