C15H12N4O5S — CID 5089043
N-[[(4-hydroxybenzoyl)amino]carbamothioyl]-4-nitrobenzamide (PubChem CID 5089043) has the molecular formula C15H12N4O5S and a molecular weight of 360.35 g/mol. Its IUPAC name is N-[[(4-hydroxybenzoyl)amino]carbamothioyl]-4-nitrobenzamide.
| Compound Name | N-[[(4-hydroxybenzoyl)amino]carbamothioyl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 5089043 |
| Molecular Formula | C15H12N4O5S |
| Molecular Weight | 360.35 g/mol |
| Exact Mass | 360.05 |
| IUPAC Name | N-[[(4-hydroxybenzoyl)amino]carbamothioyl]-4-nitrobenzamide |
| SMILES | O=C(NNC(=S)NC(=O)c1ccc([N+](=O)[O-])cc1)c1ccc(O)cc1 |
| InChI | InChI=1S/C15H12N4O5S/c20-12-7-3-10(4-8-12)14(22)17-18-15(25)16-13(21)9-1-5-11(6-2-9)19(23)24/h1-8,20H,(H,17,22)(H2,16,18,21,25) |
| InChIKey | BSJZNEBKGNNETB-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 133.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.35 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|