C18H17N3O6S — CID 2278653
ethyl 4-[(4-methoxy-3-nitrobenzoyl)carbamothioylamino]benzoate (PubChem CID 2278653) has the molecular formula C18H17N3O6S and a molecular weight of 403.42 g/mol. Its IUPAC name is ethyl 4-[(4-methoxy-3-nitrobenzoyl)carbamothioylamino]benzoate.
| Compound Name | ethyl 4-[(4-methoxy-3-nitrobenzoyl)carbamothioylamino]benzoate |
|---|---|
| PubChem CID | 2278653 |
| Molecular Formula | C18H17N3O6S |
| Molecular Weight | 403.42 g/mol |
| Exact Mass | 403.08 |
| IUPAC Name | ethyl 4-[(4-methoxy-3-nitrobenzoyl)carbamothioylamino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=S)NC(=O)c2ccc(OC)c([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C18H17N3O6S/c1-3-27-17(23)11-4-7-13(8-5-11)19-18(28)20-16(22)12-6-9-15(26-2)14(10-12)21(24)25/h4-10H,3H2,1-2H3,(H2,19,20,22,28) |
| InChIKey | HGIBZECFMPSXGO-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 119.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.42 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|