C23H27N5O5S — CID 21230245
4-ethoxy-3-nitro-N-[[4-(4-propanoylpiperazin-1-yl)phenyl]carbamothioyl]benzamide (PubChem CID 21230245) has the molecular formula C23H27N5O5S and a molecular weight of 485.57 g/mol. Its IUPAC name is 4-ethoxy-3-nitro-N-[[4-(4-propanoylpiperazin-1-yl)phenyl]carbamothioyl]benzamide.
| Compound Name | 4-ethoxy-3-nitro-N-[[4-(4-propanoylpiperazin-1-yl)phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 21230245 |
| Molecular Formula | C23H27N5O5S |
| Molecular Weight | 485.57 g/mol |
| Exact Mass | 485.17 |
| IUPAC Name | 4-ethoxy-3-nitro-N-[[4-(4-propanoylpiperazin-1-yl)phenyl]carbamothioyl]benzamide |
| SMILES | CCOc1ccc(C(=O)NC(=S)Nc2ccc(N3CCN(C(=O)CC)CC3)cc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C23H27N5O5S/c1-3-21(29)27-13-11-26(12-14-27)18-8-6-17(7-9-18)24-23(34)25-22(30)16-5-10-20(33-4-2)19(15-16)28(31)32/h5-10,15H,3-4,11-14H2,1-2H3,(H2,24,25,30,34) |
| InChIKey | ACTCVLKLMOYGLY-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 117.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.57 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|