C25H26N6O2S — CID 23097218
(E)-N-[[2-[4-(diethylamino)phenyl]-6-methylbenzotriazol-5-yl]carbamothioyl]-3-(furan-2-yl)prop-2-enamide (PubChem CID 23097218) has the molecular formula C25H26N6O2S and a molecular weight of 474.59 g/mol. Its IUPAC name is (E)-N-[[2-[4-(diethylamino)phenyl]-6-methylbenzotriazol-5-yl]carbamothioyl]-3-(furan-2-yl)prop-2-enamide.
| Compound Name | (E)-N-[[2-[4-(diethylamino)phenyl]-6-methylbenzotriazol-5-yl]carbamothioyl]-3-(furan-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 23097218 |
| Molecular Formula | C25H26N6O2S |
| Molecular Weight | 474.59 g/mol |
| Exact Mass | 474.18 |
| IUPAC Name | (E)-N-[[2-[4-(diethylamino)phenyl]-6-methylbenzotriazol-5-yl]carbamothioyl]-3-(furan-2-yl)prop-2-enamide |
| SMILES | CCN(CC)c1ccc(-n2nc3cc(C)c(NC(=S)NC(=O)/C=C/c4ccco4)cc3n2)cc1 |
| InChI | InChI=1S/C25H26N6O2S/c1-4-30(5-2)18-8-10-19(11-9-18)31-28-22-15-17(3)21(16-23(22)29-31)26-25(34)27-24(32)13-12-20-7-6-14-33-20/h6-16H,4-5H2,1-3H3,(H2,26,27,32,34)/b13-12+ |
| InChIKey | QTJHJZBUMFXMKM-OUKQBFOZSA-N |
| XLogP | 4.69 |
| TPSA | 88.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.59 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|