C24H24IN5O — CID 21167882
N-[2-[4-(diethylamino)phenyl]-6-methylbenzotriazol-5-yl]-2-iodobenzamide (PubChem CID 21167882) has the molecular formula C24H24IN5O and a molecular weight of 525.39 g/mol. Its IUPAC name is N-[2-[4-(diethylamino)phenyl]-6-methylbenzotriazol-5-yl]-2-iodobenzamide.
| Compound Name | N-[2-[4-(diethylamino)phenyl]-6-methylbenzotriazol-5-yl]-2-iodobenzamide |
|---|---|
| PubChem CID | 21167882 |
| Molecular Formula | C24H24IN5O |
| Molecular Weight | 525.39 g/mol |
| Exact Mass | 525.10 |
| IUPAC Name | N-[2-[4-(diethylamino)phenyl]-6-methylbenzotriazol-5-yl]-2-iodobenzamide |
| SMILES | CCN(CC)c1ccc(-n2nc3cc(C)c(NC(=O)c4ccccc4I)cc3n2)cc1 |
| InChI | InChI=1S/C24H24IN5O/c1-4-29(5-2)17-10-12-18(13-11-17)30-27-22-14-16(3)21(15-23(22)28-30)26-24(31)19-8-6-7-9-20(19)25/h6-15H,4-5H2,1-3H3,(H,26,31) |
| InChIKey | YHHLFEYQTXZSFL-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.39 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|