C25H26FN5O — CID 3552988
N-[2-[4-(diethylamino)-2-methylphenyl]-6-methylbenzotriazol-5-yl]-2-fluorobenzamide (PubChem CID 3552988) has the molecular formula C25H26FN5O and a molecular weight of 431.52 g/mol. Its IUPAC name is N-[2-[4-(diethylamino)-2-methylphenyl]-6-methylbenzotriazol-5-yl]-2-fluorobenzamide.
| Compound Name | N-[2-[4-(diethylamino)-2-methylphenyl]-6-methylbenzotriazol-5-yl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 3552988 |
| Molecular Formula | C25H26FN5O |
| Molecular Weight | 431.52 g/mol |
| Exact Mass | 431.21 |
| IUPAC Name | N-[2-[4-(diethylamino)-2-methylphenyl]-6-methylbenzotriazol-5-yl]-2-fluorobenzamide |
| SMILES | CCN(CC)c1ccc(-n2nc3cc(C)c(NC(=O)c4ccccc4F)cc3n2)c(C)c1 |
| InChI | InChI=1S/C25H26FN5O/c1-5-30(6-2)18-11-12-24(17(4)13-18)31-28-22-14-16(3)21(15-23(22)29-31)27-25(32)19-9-7-8-10-20(19)26/h7-15H,5-6H2,1-4H3,(H,27,32) |
| InChIKey | IPCCCZVAINSFLE-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.52 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|