C27H25Cl2N5OS — CID 17319041
3,6-dichloro-N-[2-[4-(diethylamino)-2-methylphenyl]-6-methylbenzotriazol-5-yl]-1-benzothiophene-2-carboxamide (PubChem CID 17319041) has the molecular formula C27H25Cl2N5OS and a molecular weight of 538.50 g/mol. Its IUPAC name is 3,6-dichloro-N-[2-[4-(diethylamino)-2-methylphenyl]-6-methylbenzotriazol-5-yl]-1-benzothiophene-2-carboxamide.
| Compound Name | 3,6-dichloro-N-[2-[4-(diethylamino)-2-methylphenyl]-6-methylbenzotriazol-5-yl]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 17319041 |
| Molecular Formula | C27H25Cl2N5OS |
| Molecular Weight | 538.50 g/mol |
| Exact Mass | 537.12 |
| IUPAC Name | 3,6-dichloro-N-[2-[4-(diethylamino)-2-methylphenyl]-6-methylbenzotriazol-5-yl]-1-benzothiophene-2-carboxamide |
| SMILES | CCN(CC)c1ccc(-n2nc3cc(C)c(NC(=O)c4sc5cc(Cl)ccc5c4Cl)cc3n2)c(C)c1 |
| InChI | InChI=1S/C27H25Cl2N5OS/c1-5-33(6-2)18-8-10-23(16(4)11-18)34-31-21-12-15(3)20(14-22(21)32-34)30-27(35)26-25(29)19-9-7-17(28)13-24(19)36-26/h7-14H,5-6H2,1-4H3,(H,30,35) |
| InChIKey | HHFORTYWEXURJS-UHFFFAOYSA-N |
| XLogP | 7.66 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.50 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|