C20H21ClN2OS — CID 4093726
3-chloro-N-[4-(diethylamino)phenyl]-6-methyl-1-benzothiophene-2-carboxamide (PubChem CID 4093726) has the molecular formula C20H21ClN2OS and a molecular weight of 372.92 g/mol. Its IUPAC name is 3-chloro-N-[4-(diethylamino)phenyl]-6-methyl-1-benzothiophene-2-carboxamide.
| Compound Name | 3-chloro-N-[4-(diethylamino)phenyl]-6-methyl-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 4093726 |
| Molecular Formula | C20H21ClN2OS |
| Molecular Weight | 372.92 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | 3-chloro-N-[4-(diethylamino)phenyl]-6-methyl-1-benzothiophene-2-carboxamide |
| SMILES | CCN(CC)c1ccc(NC(=O)c2sc3cc(C)ccc3c2Cl)cc1 |
| InChI | InChI=1S/C20H21ClN2OS/c1-4-23(5-2)15-9-7-14(8-10-15)22-20(24)19-18(21)16-11-6-13(3)12-17(16)25-19/h6-12H,4-5H2,1-3H3,(H,22,24) |
| InChIKey | JILIIECQBZQEDL-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.92 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|