C18H24ClNOS — CID 4081322
3-chloro-6-methyl-N-octyl-1-benzothiophene-2-carboxamide (PubChem CID 4081322) has the molecular formula C18H24ClNOS and a molecular weight of 337.92 g/mol. Its IUPAC name is 3-chloro-6-methyl-N-octyl-1-benzothiophene-2-carboxamide.
| Compound Name | 3-chloro-6-methyl-N-octyl-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 4081322 |
| Molecular Formula | C18H24ClNOS |
| Molecular Weight | 337.92 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | 3-chloro-6-methyl-N-octyl-1-benzothiophene-2-carboxamide |
| SMILES | CCCCCCCCNC(=O)c1sc2cc(C)ccc2c1Cl |
| InChI | InChI=1S/C18H24ClNOS/c1-3-4-5-6-7-8-11-20-18(21)17-16(19)14-10-9-13(2)12-15(14)22-17/h9-10,12H,3-8,11H2,1-2H3,(H,20,21) |
| InChIKey | GMVHFUSIPGDBJV-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.92 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|