C16H14ClN2OS+ — CID 4278880
3-chloro-6-methyl-N-(pyridin-1-ium-3-ylmethyl)-1-benzothiophene-2-carboxamide (PubChem CID 4278880) has the molecular formula C16H14ClN2OS+ and a molecular weight of 317.82 g/mol. Its IUPAC name is 3-chloro-6-methyl-N-(pyridin-1-ium-3-ylmethyl)-1-benzothiophene-2-carboxamide.
| Compound Name | 3-chloro-6-methyl-N-(pyridin-1-ium-3-ylmethyl)-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 4278880 |
| Molecular Formula | C16H14ClN2OS+ |
| Molecular Weight | 317.82 g/mol |
| Exact Mass | 317.05 |
| IUPAC Name | 3-chloro-6-methyl-N-(pyridin-1-ium-3-ylmethyl)-1-benzothiophene-2-carboxamide |
| SMILES | Cc1ccc2c(Cl)c(C(=O)NCc3ccc[nH+]c3)sc2c1 |
| InChI | InChI=1S/C16H13ClN2OS/c1-10-4-5-12-13(7-10)21-15(14(12)17)16(20)19-9-11-3-2-6-18-8-11/h2-8H,9H2,1H3,(H,19,20)/p+1 |
| InChIKey | AVGGXMQWEDJMQV-UHFFFAOYSA-O |
| XLogP | 3.61 |
| TPSA | 43.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.82 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |