C13H11Cl3N2O — CID 20787064
2,6-dichloro-N-(pyridin-1-ium-3-ylmethyl)benzamide chloride (PubChem CID 20787064) has the molecular formula C13H11Cl3N2O and a molecular weight of 317.60 g/mol. Its IUPAC name is 2,6-dichloro-N-(pyridin-1-ium-3-ylmethyl)benzamide chloride.
| Compound Name | 2,6-dichloro-N-(pyridin-1-ium-3-ylmethyl)benzamide chloride |
|---|---|
| PubChem CID | 20787064 |
| Molecular Formula | C13H11Cl3N2O |
| Molecular Weight | 317.60 g/mol |
| Exact Mass | 315.99 |
| IUPAC Name | 2,6-dichloro-N-(pyridin-1-ium-3-ylmethyl)benzamide chloride |
| SMILES | O=C(NCc1ccc[nH+]c1)c1c(Cl)cccc1Cl.[Cl-] |
| InChI | InChI=1S/C13H10Cl2N2O.ClH/c14-10-4-1-5-11(15)12(10)13(18)17-8-9-3-2-6-16-7-9;/h1-7H,8H2,(H,17,18);1H |
| InChIKey | HVYBVZCQDORDEE-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 43.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.60 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |