C10H10BrCl2NO — CID 43133585
N-(3-bromopropyl)-2,6-dichlorobenzamide (PubChem CID 43133585) has the molecular formula C10H10BrCl2NO and a molecular weight of 311.01 g/mol. Its IUPAC name is N-(3-bromopropyl)-2,6-dichlorobenzamide.
| Compound Name | N-(3-bromopropyl)-2,6-dichlorobenzamide |
|---|---|
| PubChem CID | 43133585 |
| Molecular Formula | C10H10BrCl2NO |
| Molecular Weight | 311.01 g/mol |
| Exact Mass | 308.93 |
| IUPAC Name | N-(3-bromopropyl)-2,6-dichlorobenzamide |
| SMILES | O=C(NCCCBr)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C10H10BrCl2NO/c11-5-2-6-14-10(15)9-7(12)3-1-4-8(9)13/h1,3-4H,2,5-6H2,(H,14,15) |
| InChIKey | ODCYHPZUSWQJLE-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.01 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|