C11H12Cl2N2OS — CID 62666216
N-(4-amino-4-sulfanylidenebutyl)-2,6-dichlorobenzamide (PubChem CID 62666216) has the molecular formula C11H12Cl2N2OS and a molecular weight of 291.20 g/mol. Its IUPAC name is N-(4-amino-4-sulfanylidenebutyl)-2,6-dichlorobenzamide.
| Compound Name | N-(4-amino-4-sulfanylidenebutyl)-2,6-dichlorobenzamide |
|---|---|
| PubChem CID | 62666216 |
| Molecular Formula | C11H12Cl2N2OS |
| Molecular Weight | 291.20 g/mol |
| Exact Mass | 290.00 |
| IUPAC Name | N-(4-amino-4-sulfanylidenebutyl)-2,6-dichlorobenzamide |
| SMILES | NC(=S)CCCNC(=O)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C11H12Cl2N2OS/c12-7-3-1-4-8(13)10(7)11(16)15-6-2-5-9(14)17/h1,3-4H,2,5-6H2,(H2,14,17)(H,15,16) |
| InChIKey | HGRQFXSBBKGHPM-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.20 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|