C10H10Cl2N4O — CID 61343646
N-(3-azidopropyl)-2,6-dichlorobenzamide (PubChem CID 61343646) has the molecular formula C10H10Cl2N4O and a molecular weight of 273.12 g/mol. Its IUPAC name is N-(3-azidopropyl)-2,6-dichlorobenzamide.
| Compound Name | N-(3-azidopropyl)-2,6-dichlorobenzamide |
|---|---|
| PubChem CID | 61343646 |
| Molecular Formula | C10H10Cl2N4O |
| Molecular Weight | 273.12 g/mol |
| Exact Mass | 272.02 |
| IUPAC Name | N-(3-azidopropyl)-2,6-dichlorobenzamide |
| SMILES | [N-]=[N+]=NCCCNC(=O)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C10H10Cl2N4O/c11-7-3-1-4-8(12)9(7)10(17)14-5-2-6-15-16-13/h1,3-4H,2,5-6H2,(H,14,17) |
| InChIKey | UOHAKJYEXFEBBE-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 77.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.12 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|