C13H19ClN2O — CID 20787052
N-(pyridin-1-ium-3-ylmethyl)cyclohexanecarboxamide chloride (PubChem CID 20787052) has the molecular formula C13H19ClN2O and a molecular weight of 254.76 g/mol. Its IUPAC name is N-(pyridin-1-ium-3-ylmethyl)cyclohexanecarboxamide chloride.
| Compound Name | N-(pyridin-1-ium-3-ylmethyl)cyclohexanecarboxamide chloride |
|---|---|
| PubChem CID | 20787052 |
| Molecular Formula | C13H19ClN2O |
| Molecular Weight | 254.76 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | N-(pyridin-1-ium-3-ylmethyl)cyclohexanecarboxamide chloride |
| SMILES | O=C(NCc1ccc[nH+]c1)C1CCCCC1.[Cl-] |
| InChI | InChI=1S/C13H18N2O.ClH/c16-13(12-6-2-1-3-7-12)15-10-11-5-4-8-14-9-11;/h4-5,8-9,12H,1-3,6-7,10H2,(H,15,16);1H |
| InChIKey | WKSPZYSGEBWCDY-UHFFFAOYSA-N |
| XLogP | -1.30 |
| TPSA | 43.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.76 |
| LogP ≤ 5 | -1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |