C11H9Cl2NOS — CID 47099946
3,6-dichloro-N-ethyl-1-benzothiophene-2-carboxamide (PubChem CID 47099946) has the molecular formula C11H9Cl2NOS and a molecular weight of 274.17 g/mol. Its IUPAC name is 3,6-dichloro-N-ethyl-1-benzothiophene-2-carboxamide.
| Compound Name | 3,6-dichloro-N-ethyl-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 47099946 |
| Molecular Formula | C11H9Cl2NOS |
| Molecular Weight | 274.17 g/mol |
| Exact Mass | 272.98 |
| IUPAC Name | 3,6-dichloro-N-ethyl-1-benzothiophene-2-carboxamide |
| SMILES | CCNC(=O)c1sc2cc(Cl)ccc2c1Cl |
| InChI | InChI=1S/C11H9Cl2NOS/c1-2-14-11(15)10-9(13)7-4-3-6(12)5-8(7)16-10/h3-5H,2H2,1H3,(H,14,15) |
| InChIKey | WLVMAGVZRIKJDX-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.17 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |