C12H13Cl3N2OS — CID 119408040
N-(3-aminopropyl)-3,6-dichloro-1-benzothiophene-2-carboxamide;hydrochloride (PubChem CID 119408040) has the molecular formula C12H13Cl3N2OS and a molecular weight of 339.68 g/mol. Its IUPAC name is N-(3-aminopropyl)-3,6-dichloro-1-benzothiophene-2-carboxamide;hydrochloride.
| Compound Name | N-(3-aminopropyl)-3,6-dichloro-1-benzothiophene-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119408040 |
| Molecular Formula | C12H13Cl3N2OS |
| Molecular Weight | 339.68 g/mol |
| Exact Mass | 337.98 |
| IUPAC Name | N-(3-aminopropyl)-3,6-dichloro-1-benzothiophene-2-carboxamide;hydrochloride |
| SMILES | Cl.NCCCNC(=O)c1sc2cc(Cl)ccc2c1Cl |
| InChI | InChI=1S/C12H12Cl2N2OS.ClH/c13-7-2-3-8-9(6-7)18-11(10(8)14)12(17)16-5-1-4-15;/h2-3,6H,1,4-5,15H2,(H,16,17);1H |
| InChIKey | UYTIOZHHRYOXLZ-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.68 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|