C14H15Cl2NO2S2 — CID 103800775
3,6-dichloro-N-[2-(3-hydroxypropylsulfanyl)ethyl]-1-benzothiophene-2-carboxamide (PubChem CID 103800775) has the molecular formula C14H15Cl2NO2S2 and a molecular weight of 364.32 g/mol. Its IUPAC name is 3,6-dichloro-N-[2-(3-hydroxypropylsulfanyl)ethyl]-1-benzothiophene-2-carboxamide.
| Compound Name | 3,6-dichloro-N-[2-(3-hydroxypropylsulfanyl)ethyl]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 103800775 |
| Molecular Formula | C14H15Cl2NO2S2 |
| Molecular Weight | 364.32 g/mol |
| Exact Mass | 362.99 |
| IUPAC Name | 3,6-dichloro-N-[2-(3-hydroxypropylsulfanyl)ethyl]-1-benzothiophene-2-carboxamide |
| SMILES | O=C(NCCSCCCO)c1sc2cc(Cl)ccc2c1Cl |
| InChI | InChI=1S/C14H15Cl2NO2S2/c15-9-2-3-10-11(8-9)21-13(12(10)16)14(19)17-4-7-20-6-1-5-18/h2-3,8,18H,1,4-7H2,(H,17,19) |
| InChIKey | NXZHAZDUVFRKMI-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.32 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|