C16H18Cl2N2OS — CID 119558468
3,6-dichloro-N-(2-piperidin-3-ylethyl)-1-benzothiophene-2-carboxamide (PubChem CID 119558468) has the molecular formula C16H18Cl2N2OS and a molecular weight of 357.31 g/mol. Its IUPAC name is 3,6-dichloro-N-(2-piperidin-3-ylethyl)-1-benzothiophene-2-carboxamide.
| Compound Name | 3,6-dichloro-N-(2-piperidin-3-ylethyl)-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 119558468 |
| Molecular Formula | C16H18Cl2N2OS |
| Molecular Weight | 357.31 g/mol |
| Exact Mass | 356.05 |
| IUPAC Name | 3,6-dichloro-N-(2-piperidin-3-ylethyl)-1-benzothiophene-2-carboxamide |
| SMILES | O=C(NCCC1CCCNC1)c1sc2cc(Cl)ccc2c1Cl |
| InChI | InChI=1S/C16H18Cl2N2OS/c17-11-3-4-12-13(8-11)22-15(14(12)18)16(21)20-7-5-10-2-1-6-19-9-10/h3-4,8,10,19H,1-2,5-7,9H2,(H,20,21) |
| InChIKey | BUNOCCANFPYHNZ-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.31 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |