C17H21Cl2N3OS — CID 121238065
3,6-dichloro-N-[3-(4-methylpiperazin-1-yl)propyl]-1-benzothiophene-2-carboxamide (PubChem CID 121238065) has the molecular formula C17H21Cl2N3OS and a molecular weight of 386.35 g/mol. Its IUPAC name is 3,6-dichloro-N-[3-(4-methylpiperazin-1-yl)propyl]-1-benzothiophene-2-carboxamide.
| Compound Name | 3,6-dichloro-N-[3-(4-methylpiperazin-1-yl)propyl]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 121238065 |
| Molecular Formula | C17H21Cl2N3OS |
| Molecular Weight | 386.35 g/mol |
| Exact Mass | 385.08 |
| IUPAC Name | 3,6-dichloro-N-[3-(4-methylpiperazin-1-yl)propyl]-1-benzothiophene-2-carboxamide |
| SMILES | CN1CCN(CCCNC(=O)c2sc3cc(Cl)ccc3c2Cl)CC1 |
| InChI | InChI=1S/C17H21Cl2N3OS/c1-21-7-9-22(10-8-21)6-2-5-20-17(23)16-15(19)13-4-3-12(18)11-14(13)24-16/h3-4,11H,2,5-10H2,1H3,(H,20,23) |
| InChIKey | GZAXVWCLXRHZSP-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.35 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|