C18H22ClFN2O2S — CID 55629184
3-chloro-N-[3-(2,6-dimethylmorpholin-4-yl)propyl]-6-fluoro-1-benzothiophene-2-carboxamide (PubChem CID 55629184) has the molecular formula C18H22ClFN2O2S and a molecular weight of 384.90 g/mol. Its IUPAC name is 3-chloro-N-[3-(2,6-dimethylmorpholin-4-yl)propyl]-6-fluoro-1-benzothiophene-2-carboxamide.
| Compound Name | 3-chloro-N-[3-(2,6-dimethylmorpholin-4-yl)propyl]-6-fluoro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 55629184 |
| Molecular Formula | C18H22ClFN2O2S |
| Molecular Weight | 384.90 g/mol |
| Exact Mass | 384.11 |
| IUPAC Name | 3-chloro-N-[3-(2,6-dimethylmorpholin-4-yl)propyl]-6-fluoro-1-benzothiophene-2-carboxamide |
| SMILES | CC1CN(CCCNC(=O)c2sc3cc(F)ccc3c2Cl)CC(C)O1 |
| InChI | InChI=1S/C18H22ClFN2O2S/c1-11-9-22(10-12(2)24-11)7-3-6-21-18(23)17-16(19)14-5-4-13(20)8-15(14)25-17/h4-5,8,11-12H,3,6-7,9-10H2,1-2H3,(H,21,23) |
| InChIKey | UAQBTLMGCMNNRA-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.90 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|