C12H8Cl2FNOS — CID 115636901
3-chloro-N-(2-chloroprop-2-enyl)-6-fluoro-1-benzothiophene-2-carboxamide (PubChem CID 115636901) has the molecular formula C12H8Cl2FNOS and a molecular weight of 304.17 g/mol. Its IUPAC name is 3-chloro-N-(2-chloroprop-2-enyl)-6-fluoro-1-benzothiophene-2-carboxamide.
| Compound Name | 3-chloro-N-(2-chloroprop-2-enyl)-6-fluoro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 115636901 |
| Molecular Formula | C12H8Cl2FNOS |
| Molecular Weight | 304.17 g/mol |
| Exact Mass | 302.97 |
| IUPAC Name | 3-chloro-N-(2-chloroprop-2-enyl)-6-fluoro-1-benzothiophene-2-carboxamide |
| SMILES | C=C(Cl)CNC(=O)c1sc2cc(F)ccc2c1Cl |
| InChI | InChI=1S/C12H8Cl2FNOS/c1-6(13)5-16-12(17)11-10(14)8-3-2-7(15)4-9(8)18-11/h2-4H,1,5H2,(H,16,17) |
| InChIKey | DTSDLNRFSIBXRU-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.17 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |