C12H10ClFN2O3S — CID 106164712
N-(3-amino-2-hydroxy-3-oxopropyl)-3-chloro-6-fluoro-1-benzothiophene-2-carboxamide (PubChem CID 106164712) has the molecular formula C12H10ClFN2O3S and a molecular weight of 316.74 g/mol. Its IUPAC name is N-(3-amino-2-hydroxy-3-oxopropyl)-3-chloro-6-fluoro-1-benzothiophene-2-carboxamide.
| Compound Name | N-(3-amino-2-hydroxy-3-oxopropyl)-3-chloro-6-fluoro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 106164712 |
| Molecular Formula | C12H10ClFN2O3S |
| Molecular Weight | 316.74 g/mol |
| Exact Mass | 316.01 |
| IUPAC Name | N-(3-amino-2-hydroxy-3-oxopropyl)-3-chloro-6-fluoro-1-benzothiophene-2-carboxamide |
| SMILES | NC(=O)C(O)CNC(=O)c1sc2cc(F)ccc2c1Cl |
| InChI | InChI=1S/C12H10ClFN2O3S/c13-9-6-2-1-5(14)3-8(6)20-10(9)12(19)16-4-7(17)11(15)18/h1-3,7,17H,4H2,(H2,15,18)(H,16,19) |
| InChIKey | CKJMKYODTFTWDR-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.74 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |