C13H13ClFNO2S — CID 43390261
3-chloro-6-fluoro-N-(1-hydroxybutan-2-yl)-1-benzothiophene-2-carboxamide (PubChem CID 43390261) has the molecular formula C13H13ClFNO2S and a molecular weight of 301.77 g/mol. Its IUPAC name is 3-chloro-6-fluoro-N-(1-hydroxybutan-2-yl)-1-benzothiophene-2-carboxamide.
| Compound Name | 3-chloro-6-fluoro-N-(1-hydroxybutan-2-yl)-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 43390261 |
| Molecular Formula | C13H13ClFNO2S |
| Molecular Weight | 301.77 g/mol |
| Exact Mass | 301.03 |
| IUPAC Name | 3-chloro-6-fluoro-N-(1-hydroxybutan-2-yl)-1-benzothiophene-2-carboxamide |
| SMILES | CCC(CO)NC(=O)c1sc2cc(F)ccc2c1Cl |
| InChI | InChI=1S/C13H13ClFNO2S/c1-2-8(6-17)16-13(18)12-11(14)9-4-3-7(15)5-10(9)19-12/h3-5,8,17H,2,6H2,1H3,(H,16,18) |
| InChIKey | RIHOSGGKGXXOIP-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.77 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |