C12H7ClFNOS — CID 18110036
3-chloro-6-fluoro-N-prop-2-ynyl-1-benzothiophene-2-carboxamide (PubChem CID 18110036) has the molecular formula C12H7ClFNOS and a molecular weight of 267.71 g/mol. Its IUPAC name is 3-chloro-6-fluoro-N-prop-2-ynyl-1-benzothiophene-2-carboxamide.
| Compound Name | 3-chloro-6-fluoro-N-prop-2-ynyl-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 18110036 |
| Molecular Formula | C12H7ClFNOS |
| Molecular Weight | 267.71 g/mol |
| Exact Mass | 266.99 |
| IUPAC Name | 3-chloro-6-fluoro-N-prop-2-ynyl-1-benzothiophene-2-carboxamide |
| SMILES | C#CCNC(=O)c1sc2cc(F)ccc2c1Cl |
| InChI | InChI=1S/C12H7ClFNOS/c1-2-5-15-12(16)11-10(13)8-4-3-7(14)6-9(8)17-11/h1,3-4,6H,5H2,(H,15,16) |
| InChIKey | SBSUYGZEJVEVKR-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.71 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|