C14H15ClFNO2S — CID 66108609
3-chloro-6-fluoro-N-(4-hydroxy-2-methylbutyl)-1-benzothiophene-2-carboxamide (PubChem CID 66108609) has the molecular formula C14H15ClFNO2S and a molecular weight of 315.80 g/mol. Its IUPAC name is 3-chloro-6-fluoro-N-(4-hydroxy-2-methylbutyl)-1-benzothiophene-2-carboxamide.
| Compound Name | 3-chloro-6-fluoro-N-(4-hydroxy-2-methylbutyl)-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 66108609 |
| Molecular Formula | C14H15ClFNO2S |
| Molecular Weight | 315.80 g/mol |
| Exact Mass | 315.05 |
| IUPAC Name | 3-chloro-6-fluoro-N-(4-hydroxy-2-methylbutyl)-1-benzothiophene-2-carboxamide |
| SMILES | CC(CCO)CNC(=O)c1sc2cc(F)ccc2c1Cl |
| InChI | InChI=1S/C14H15ClFNO2S/c1-8(4-5-18)7-17-14(19)13-12(15)10-3-2-9(16)6-11(10)20-13/h2-3,6,8,18H,4-5,7H2,1H3,(H,17,19) |
| InChIKey | YDPMIVNTGOXOAU-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.80 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |