C20H20ClFN2OS — CID 41306578
N-[3-[benzyl(methyl)amino]propyl]-3-chloro-6-fluoro-1-benzothiophene-2-carboxamide (PubChem CID 41306578) has the molecular formula C20H20ClFN2OS and a molecular weight of 390.91 g/mol. Its IUPAC name is N-[3-[benzyl(methyl)amino]propyl]-3-chloro-6-fluoro-1-benzothiophene-2-carboxamide.
| Compound Name | N-[3-[benzyl(methyl)amino]propyl]-3-chloro-6-fluoro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 41306578 |
| Molecular Formula | C20H20ClFN2OS |
| Molecular Weight | 390.91 g/mol |
| Exact Mass | 390.10 |
| IUPAC Name | N-[3-[benzyl(methyl)amino]propyl]-3-chloro-6-fluoro-1-benzothiophene-2-carboxamide |
| SMILES | CN(CCCNC(=O)c1sc2cc(F)ccc2c1Cl)Cc1ccccc1 |
| InChI | InChI=1S/C20H20ClFN2OS/c1-24(13-14-6-3-2-4-7-14)11-5-10-23-20(25)19-18(21)16-9-8-15(22)12-17(16)26-19/h2-4,6-9,12H,5,10-11,13H2,1H3,(H,23,25) |
| InChIKey | PDYHPJBJBYQOBT-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.91 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|