C17H13ClFNOS — CID 18190734
3-chloro-N-ethyl-6-fluoro-N-phenyl-1-benzothiophene-2-carboxamide (PubChem CID 18190734) has the molecular formula C17H13ClFNOS and a molecular weight of 333.82 g/mol. Its IUPAC name is 3-chloro-N-ethyl-6-fluoro-N-phenyl-1-benzothiophene-2-carboxamide.
| Compound Name | 3-chloro-N-ethyl-6-fluoro-N-phenyl-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 18190734 |
| Molecular Formula | C17H13ClFNOS |
| Molecular Weight | 333.82 g/mol |
| Exact Mass | 333.04 |
| IUPAC Name | 3-chloro-N-ethyl-6-fluoro-N-phenyl-1-benzothiophene-2-carboxamide |
| SMILES | CCN(C(=O)c1sc2cc(F)ccc2c1Cl)c1ccccc1 |
| InChI | InChI=1S/C17H13ClFNOS/c1-2-20(12-6-4-3-5-7-12)17(21)16-15(18)13-9-8-11(19)10-14(13)22-16/h3-10H,2H2,1H3 |
| InChIKey | ALZVDPIRHHNGMV-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.82 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |