C16H12ClFN2OS — CID 71888961
3-chloro-6-fluoro-N-methyl-N-(pyridin-2-ylmethyl)-1-benzothiophene-2-carboxamide (PubChem CID 71888961) has the molecular formula C16H12ClFN2OS and a molecular weight of 334.80 g/mol. Its IUPAC name is 3-chloro-6-fluoro-N-methyl-N-(pyridin-2-ylmethyl)-1-benzothiophene-2-carboxamide.
| Compound Name | 3-chloro-6-fluoro-N-methyl-N-(pyridin-2-ylmethyl)-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 71888961 |
| Molecular Formula | C16H12ClFN2OS |
| Molecular Weight | 334.80 g/mol |
| Exact Mass | 334.03 |
| IUPAC Name | 3-chloro-6-fluoro-N-methyl-N-(pyridin-2-ylmethyl)-1-benzothiophene-2-carboxamide |
| SMILES | CN(Cc1ccccn1)C(=O)c1sc2cc(F)ccc2c1Cl |
| InChI | InChI=1S/C16H12ClFN2OS/c1-20(9-11-4-2-3-7-19-11)16(21)15-14(17)12-6-5-10(18)8-13(12)22-15/h2-8H,9H2,1H3 |
| InChIKey | NSTLOPIYTPXCMZ-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.80 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |