C12H12KN2OS — CID 69258575
CID 69258575 (PubChem CID 69258575) has the molecular formula C12H12KN2OS and a molecular weight of 271.41 g/mol.
| Compound Name | CID 69258575 |
|---|---|
| PubChem CID | 69258575 |
| Molecular Formula | C12H12KN2OS |
| Molecular Weight | 271.41 g/mol |
| Exact Mass | 271.03 |
| IUPAC Name | — |
| SMILES | CN(Cc1ccccn1)C(=O)c1cccs1.[K] |
| InChI | InChI=1S/C12H12N2OS.K/c1-14(9-10-5-2-3-7-13-10)12(15)11-6-4-8-16-11;/h2-8H,9H2,1H3; |
| InChIKey | RJKJAIFRZMERSO-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.41 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |